C20H21N3OS — CID 152802138
1,6',6'-trimethylspiro[2H-indole-3,9'-5,7-dihydro-4H-[1,3]thiazolo[4,5-b]quinoline]-8'-one (PubChem CID 152802138) has the molecular formula C20H21N3OS and a molecular weight of 351.47 g/mol. Its IUPAC name is 1,6',6'-trimethylspiro[2H-indole-3,9'-5,7-dihydro-4H-[1,3]thiazolo[4,5-b]quinoline]-8'-one.
| Compound Name | 1,6',6'-trimethylspiro[2H-indole-3,9'-5,7-dihydro-4H-[1,3]thiazolo[4,5-b]quinoline]-8'-one |
|---|---|
| PubChem CID | 152802138 |
| Molecular Formula | C20H21N3OS |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 1,6',6'-trimethylspiro[2H-indole-3,9'-5,7-dihydro-4H-[1,3]thiazolo[4,5-b]quinoline]-8'-one |
| SMILES | CN1CC2(C3=C(CC(C)(C)CC3=O)Nc3ncsc32)c2ccccc21 |
| InChI | InChI=1S/C20H21N3OS/c1-19(2)8-13-16(15(24)9-19)20(17-18(22-13)21-11-25-17)10-23(3)14-7-5-4-6-12(14)20/h4-7,11,22H,8-10H2,1-3H3 |
| InChIKey | SOFOQTJJYCSHDC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |