C26H26N2O2 — CID 132544474
3,3,7-trimethyl-1'-prop-2-enylspiro[4,10-dihydro-2H-acridine-9,3'-indole]-1,2'-dione (PubChem CID 132544474) has the molecular formula C26H26N2O2 and a molecular weight of 398.51 g/mol. Its IUPAC name is 3,3,7-trimethyl-1'-prop-2-enylspiro[4,10-dihydro-2H-acridine-9,3'-indole]-1,2'-dione.
| Compound Name | 3,3,7-trimethyl-1'-prop-2-enylspiro[4,10-dihydro-2H-acridine-9,3'-indole]-1,2'-dione |
|---|---|
| PubChem CID | 132544474 |
| Molecular Formula | C26H26N2O2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 3,3,7-trimethyl-1'-prop-2-enylspiro[4,10-dihydro-2H-acridine-9,3'-indole]-1,2'-dione |
| SMILES | C=CCN1C(=O)C2(C3=C(CC(C)(C)CC3=O)Nc3ccc(C)cc32)c2ccccc21 |
| InChI | InChI=1S/C26H26N2O2/c1-5-12-28-21-9-7-6-8-17(21)26(24(28)30)18-13-16(2)10-11-19(18)27-20-14-25(3,4)15-22(29)23(20)26/h5-11,13,27H,1,12,14-15H2,2-4H3 |
| InChIKey | CHSIELHVHRFXPZ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|