C28H28ClN3O4 — CID 23858278
ethyl 2'-amino-1'-(2-chlorophenyl)-5,7',7'-trimethyl-2,5'-dioxospiro[1H-indole-3,4'-6,8-dihydroquinoline]-3'-carboxylate (PubChem CID 23858278) has the molecular formula C28H28ClN3O4 and a molecular weight of 506.00 g/mol. Its IUPAC name is ethyl 2'-amino-1'-(2-chlorophenyl)-5,7',7'-trimethyl-2,5'-dioxospiro[1H-indole-3,4'-6,8-dihydroquinoline]-3'-carboxylate.
| Compound Name | ethyl 2'-amino-1'-(2-chlorophenyl)-5,7',7'-trimethyl-2,5'-dioxospiro[1H-indole-3,4'-6,8-dihydroquinoline]-3'-carboxylate |
|---|---|
| PubChem CID | 23858278 |
| Molecular Formula | C28H28ClN3O4 |
| Molecular Weight | 506.00 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | ethyl 2'-amino-1'-(2-chlorophenyl)-5,7',7'-trimethyl-2,5'-dioxospiro[1H-indole-3,4'-6,8-dihydroquinoline]-3'-carboxylate |
| SMILES | CCOC(=O)C1=C(N)N(c2ccccc2Cl)C2=C(C(=O)CC(C)(C)C2)C12C(=O)Nc1ccc(C)cc12 |
| InChI | InChI=1S/C28H28ClN3O4/c1-5-36-25(34)23-24(30)32(19-9-7-6-8-17(19)29)20-13-27(3,4)14-21(33)22(20)28(23)16-12-15(2)10-11-18(16)31-26(28)35/h6-12H,5,13-14,30H2,1-4H3,(H,31,35) |
| InChIKey | ILHXQVBZAWNYDJ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.00 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |