C27H24Cl3N3O4 — CID 23942125
ethyl 2'-amino-5-chloro-1'-(2,4-dichlorophenyl)-7',7'-dimethyl-2,5'-dioxospiro[1H-indole-3,4'-6,8-dihydroquinoline]-3'-carboxylate (PubChem CID 23942125) has the molecular formula C27H24Cl3N3O4 and a molecular weight of 560.87 g/mol. Its IUPAC name is ethyl 2'-amino-5-chloro-1'-(2,4-dichlorophenyl)-7',7'-dimethyl-2,5'-dioxospiro[1H-indole-3,4'-6,8-dihydroquinoline]-3'-carboxylate.
| Compound Name | ethyl 2'-amino-5-chloro-1'-(2,4-dichlorophenyl)-7',7'-dimethyl-2,5'-dioxospiro[1H-indole-3,4'-6,8-dihydroquinoline]-3'-carboxylate |
|---|---|
| PubChem CID | 23942125 |
| Molecular Formula | C27H24Cl3N3O4 |
| Molecular Weight | 560.87 g/mol |
| Exact Mass | 559.08 |
| IUPAC Name | ethyl 2'-amino-5-chloro-1'-(2,4-dichlorophenyl)-7',7'-dimethyl-2,5'-dioxospiro[1H-indole-3,4'-6,8-dihydroquinoline]-3'-carboxylate |
| SMILES | CCOC(=O)C1=C(N)N(c2ccc(Cl)cc2Cl)C2=C(C(=O)CC(C)(C)C2)C12C(=O)Nc1ccc(Cl)cc12 |
| InChI | InChI=1S/C27H24Cl3N3O4/c1-4-37-24(35)22-23(31)33(18-8-6-14(29)10-16(18)30)19-11-26(2,3)12-20(34)21(19)27(22)15-9-13(28)5-7-17(15)32-25(27)36/h5-10H,4,11-12,31H2,1-3H3,(H,32,36) |
| InChIKey | SWMBXUGJXZOZCZ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.87 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |