C26H22Cl3N3O4 — CID 23914150
methyl 2'-amino-5-chloro-1'-(2,5-dichlorophenyl)-7',7'-dimethyl-2,5'-dioxospiro[1H-indole-3,4'-6,8-dihydroquinoline]-3'-carboxylate (PubChem CID 23914150) has the molecular formula C26H22Cl3N3O4 and a molecular weight of 546.84 g/mol. Its IUPAC name is methyl 2'-amino-5-chloro-1'-(2,5-dichlorophenyl)-7',7'-dimethyl-2,5'-dioxospiro[1H-indole-3,4'-6,8-dihydroquinoline]-3'-carboxylate.
| Compound Name | methyl 2'-amino-5-chloro-1'-(2,5-dichlorophenyl)-7',7'-dimethyl-2,5'-dioxospiro[1H-indole-3,4'-6,8-dihydroquinoline]-3'-carboxylate |
|---|---|
| PubChem CID | 23914150 |
| Molecular Formula | C26H22Cl3N3O4 |
| Molecular Weight | 546.84 g/mol |
| Exact Mass | 545.07 |
| IUPAC Name | methyl 2'-amino-5-chloro-1'-(2,5-dichlorophenyl)-7',7'-dimethyl-2,5'-dioxospiro[1H-indole-3,4'-6,8-dihydroquinoline]-3'-carboxylate |
| SMILES | COC(=O)C1=C(N)N(c2cc(Cl)ccc2Cl)C2=C(C(=O)CC(C)(C)C2)C12C(=O)Nc1ccc(Cl)cc12 |
| InChI | InChI=1S/C26H22Cl3N3O4/c1-25(2)10-18-20(19(33)11-25)26(14-8-12(27)5-7-16(14)31-24(26)35)21(23(34)36-3)22(30)32(18)17-9-13(28)4-6-15(17)29/h4-9H,10-11,30H2,1-3H3,(H,31,35) |
| InChIKey | CAFSGDXUODNCJG-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.84 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |