C28H29N3O4 — CID 23886038
methyl 2'-amino-1'-(2,5-dimethylphenyl)-7',7'-dimethyl-2,5'-dioxospiro[1H-indole-3,4'-6,8-dihydroquinoline]-3'-carboxylate (PubChem CID 23886038) has the molecular formula C28H29N3O4 and a molecular weight of 471.56 g/mol. Its IUPAC name is methyl 2'-amino-1'-(2,5-dimethylphenyl)-7',7'-dimethyl-2,5'-dioxospiro[1H-indole-3,4'-6,8-dihydroquinoline]-3'-carboxylate.
| Compound Name | methyl 2'-amino-1'-(2,5-dimethylphenyl)-7',7'-dimethyl-2,5'-dioxospiro[1H-indole-3,4'-6,8-dihydroquinoline]-3'-carboxylate |
|---|---|
| PubChem CID | 23886038 |
| Molecular Formula | C28H29N3O4 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | methyl 2'-amino-1'-(2,5-dimethylphenyl)-7',7'-dimethyl-2,5'-dioxospiro[1H-indole-3,4'-6,8-dihydroquinoline]-3'-carboxylate |
| SMILES | COC(=O)C1=C(N)N(c2cc(C)ccc2C)C2=C(C(=O)CC(C)(C)C2)C12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C28H29N3O4/c1-15-10-11-16(2)19(12-15)31-20-13-27(3,4)14-21(32)22(20)28(23(24(31)29)25(33)35-5)17-8-6-7-9-18(17)30-26(28)34/h6-12H,13-14,29H2,1-5H3,(H,30,34) |
| InChIKey | OHTGLAOYSCQLAR-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |