C29H30ClN3O4 — CID 23970025
ethyl 2'-amino-5-chloro-1'-(2,3-dimethylphenyl)-7',7'-dimethyl-2,5'-dioxospiro[1H-indole-3,4'-6,8-dihydroquinoline]-3'-carboxylate (PubChem CID 23970025) has the molecular formula C29H30ClN3O4 and a molecular weight of 520.03 g/mol. Its IUPAC name is ethyl 2'-amino-5-chloro-1'-(2,3-dimethylphenyl)-7',7'-dimethyl-2,5'-dioxospiro[1H-indole-3,4'-6,8-dihydroquinoline]-3'-carboxylate.
| Compound Name | ethyl 2'-amino-5-chloro-1'-(2,3-dimethylphenyl)-7',7'-dimethyl-2,5'-dioxospiro[1H-indole-3,4'-6,8-dihydroquinoline]-3'-carboxylate |
|---|---|
| PubChem CID | 23970025 |
| Molecular Formula | C29H30ClN3O4 |
| Molecular Weight | 520.03 g/mol |
| Exact Mass | 519.19 |
| IUPAC Name | ethyl 2'-amino-5-chloro-1'-(2,3-dimethylphenyl)-7',7'-dimethyl-2,5'-dioxospiro[1H-indole-3,4'-6,8-dihydroquinoline]-3'-carboxylate |
| SMILES | CCOC(=O)C1=C(N)N(c2cccc(C)c2C)C2=C(C(=O)CC(C)(C)C2)C12C(=O)Nc1ccc(Cl)cc12 |
| InChI | InChI=1S/C29H30ClN3O4/c1-6-37-26(35)24-25(31)33(20-9-7-8-15(2)16(20)3)21-13-28(4,5)14-22(34)23(21)29(24)18-12-17(30)10-11-19(18)32-27(29)36/h7-12H,6,13-14,31H2,1-5H3,(H,32,36) |
| InChIKey | JYWKHXKJZCCWDB-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.03 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |