C20H24N2OS — CID 166894229
(9R)-9-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-6,6,9-trimethyl-5,7-dihydro-4H-[1,3]thiazolo[4,5-b]quinolin-8-one (PubChem CID 166894229) has the molecular formula C20H24N2OS and a molecular weight of 340.49 g/mol. Its IUPAC name is (9R)-9-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-6,6,9-trimethyl-5,7-dihydro-4H-[1,3]thiazolo[4,5-b]quinolin-8-one.
| Compound Name | (9R)-9-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-6,6,9-trimethyl-5,7-dihydro-4H-[1,3]thiazolo[4,5-b]quinolin-8-one |
|---|---|
| PubChem CID | 166894229 |
| Molecular Formula | C20H24N2OS |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | (9R)-9-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-6,6,9-trimethyl-5,7-dihydro-4H-[1,3]thiazolo[4,5-b]quinolin-8-one |
| SMILES | C=C(/C=C\C=C/C)[C@]1(C)C2=C(CC(C)(C)CC2=O)Nc2ncsc21 |
| InChI | InChI=1S/C20H24N2OS/c1-6-7-8-9-13(2)20(5)16-14(10-19(3,4)11-15(16)23)22-18-17(20)24-12-21-18/h6-9,12,22H,2,10-11H2,1,3-5H3/b7-6-,9-8-/t20-/m1/s1 |
| InChIKey | NFEGVIAUGVKMDL-GHTOBUQLSA-N |
| XLogP | 5.16 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|