C17H25N3O — CID 136980398
4,4-diethyl-3,7,7-trimethyl-2,6,8,9-tetrahydropyrazolo[3,4-b]quinolin-5-one (PubChem CID 136980398) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is 4,4-diethyl-3,7,7-trimethyl-2,6,8,9-tetrahydropyrazolo[3,4-b]quinolin-5-one.
| Compound Name | 4,4-diethyl-3,7,7-trimethyl-2,6,8,9-tetrahydropyrazolo[3,4-b]quinolin-5-one |
|---|---|
| PubChem CID | 136980398 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | 4,4-diethyl-3,7,7-trimethyl-2,6,8,9-tetrahydropyrazolo[3,4-b]quinolin-5-one |
| SMILES | CCC1(CC)C2=C(CC(C)(C)CC2=O)Nc2n[nH]c(C)c21 |
| InChI | InChI=1S/C17H25N3O/c1-6-17(7-2)13-10(3)19-20-15(13)18-11-8-16(4,5)9-12(21)14(11)17/h6-9H2,1-5H3,(H2,18,19,20) |
| InChIKey | ZKLKMNNNFCZKDV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |