C24H24F3N3O — CID 163730779
(3S)-3'-(3,3-difluorocyclobutyl)-6-fluoro-7',7'-dimethylspiro[1,2-dihydroindene-3,4'-2,6,8,9-tetrahydropyrazolo[3,4-b]quinoline]-5'-one (PubChem CID 163730779) has the molecular formula C24H24F3N3O and a molecular weight of 427.47 g/mol. Its IUPAC name is (3S)-3'-(3,3-difluorocyclobutyl)-6-fluoro-7',7'-dimethylspiro[1,2-dihydroindene-3,4'-2,6,8,9-tetrahydropyrazolo[3,4-b]quinoline]-5'-one.
| Compound Name | (3S)-3'-(3,3-difluorocyclobutyl)-6-fluoro-7',7'-dimethylspiro[1,2-dihydroindene-3,4'-2,6,8,9-tetrahydropyrazolo[3,4-b]quinoline]-5'-one |
|---|---|
| PubChem CID | 163730779 |
| Molecular Formula | C24H24F3N3O |
| Molecular Weight | 427.47 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | (3S)-3'-(3,3-difluorocyclobutyl)-6-fluoro-7',7'-dimethylspiro[1,2-dihydroindene-3,4'-2,6,8,9-tetrahydropyrazolo[3,4-b]quinoline]-5'-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1n[nH]c(C3CC(F)(F)C3)c1[C@@]21CCc2cc(F)ccc21 |
| InChI | InChI=1S/C24H24F3N3O/c1-22(2)10-16-18(17(31)11-22)24(6-5-12-7-14(25)3-4-15(12)24)19-20(29-30-21(19)28-16)13-8-23(26,27)9-13/h3-4,7,13H,5-6,8-11H2,1-2H3,(H2,28,29,30)/t24-/m1/s1 |
| InChIKey | KZJAJWQLBPSDAV-XMMPIXPASA-N |
| XLogP | 5.36 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.47 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |