C23H26FN3O — CID 136969763
(4R)-3-cyclopropyl-4-[3-(fluoromethyl)phenyl]-4,7,7-trimethyl-2,6,8,9-tetrahydropyrazolo[3,4-b]quinolin-5-one (PubChem CID 136969763) has the molecular formula C23H26FN3O and a molecular weight of 379.48 g/mol. Its IUPAC name is (4R)-3-cyclopropyl-4-[3-(fluoromethyl)phenyl]-4,7,7-trimethyl-2,6,8,9-tetrahydropyrazolo[3,4-b]quinolin-5-one.
| Compound Name | (4R)-3-cyclopropyl-4-[3-(fluoromethyl)phenyl]-4,7,7-trimethyl-2,6,8,9-tetrahydropyrazolo[3,4-b]quinolin-5-one |
|---|---|
| PubChem CID | 136969763 |
| Molecular Formula | C23H26FN3O |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | (4R)-3-cyclopropyl-4-[3-(fluoromethyl)phenyl]-4,7,7-trimethyl-2,6,8,9-tetrahydropyrazolo[3,4-b]quinolin-5-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1n[nH]c(C3CC3)c1[C@@]2(C)c1cccc(CF)c1 |
| InChI | InChI=1S/C23H26FN3O/c1-22(2)10-16-18(17(28)11-22)23(3,15-6-4-5-13(9-15)12-24)19-20(14-7-8-14)26-27-21(19)25-16/h4-6,9,14H,7-8,10-12H2,1-3H3,(H2,25,26,27)/t23-/m0/s1 |
| InChIKey | XBFCWCIVWYOYDY-QHCPKHFHSA-N |
| XLogP | 5.13 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |