C39H40Br2N2O2 — CID 101384590
2-[4-[6-(2,7-dibromo-9-hexylfluoren-9-yl)hexoxy]phenyl]-5-phenyl-1,3,4-oxadiazole (PubChem CID 101384590) has the molecular formula C39H40Br2N2O2 and a molecular weight of 728.57 g/mol. Its IUPAC name is 2-[4-[6-(2,7-dibromo-9-hexylfluoren-9-yl)hexoxy]phenyl]-5-phenyl-1,3,4-oxadiazole.
| Compound Name | 2-[4-[6-(2,7-dibromo-9-hexylfluoren-9-yl)hexoxy]phenyl]-5-phenyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 101384590 |
| Molecular Formula | C39H40Br2N2O2 |
| Molecular Weight | 728.57 g/mol |
| Exact Mass | 726.15 |
| IUPAC Name | 2-[4-[6-(2,7-dibromo-9-hexylfluoren-9-yl)hexoxy]phenyl]-5-phenyl-1,3,4-oxadiazole |
| SMILES | CCCCCCC1(CCCCCCOc2ccc(-c3nnc(-c4ccccc4)o3)cc2)c2cc(Br)ccc2-c2ccc(Br)cc21 |
| InChI | InChI=1S/C39H40Br2N2O2/c1-2-3-4-10-23-39(35-26-30(40)17-21-33(35)34-22-18-31(41)27-36(34)39)24-11-5-6-12-25-44-32-19-15-29(16-20-32)38-43-42-37(45-38)28-13-8-7-9-14-28/h7-9,13-22,26-27H,2-6,10-12,23-25H2,1H3 |
| InChIKey | RMWHXQAODHIXDX-UHFFFAOYSA-N |
| XLogP | 12.19 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.57 |
| LogP ≤ 5 | 12.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|