C30H45N7O8 — CID 101385267
(2S)-6-amino-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[(2-aminoacetyl)amino]-4-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid (PubChem CID 101385267) has the molecular formula C30H45N7O8 and a molecular weight of 631.73 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[(2-aminoacetyl)amino]-4-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[(2-aminoacetyl)amino]-4-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 101385267 |
| Molecular Formula | C30H45N7O8 |
| Molecular Weight | 631.73 g/mol |
| Exact Mass | 631.33 |
| IUPAC Name | (2S)-6-amino-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[(2-aminoacetyl)amino]-4-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)CN)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCCCN)C(=O)O |
| InChI | InChI=1S/C30H45N7O8/c1-17(2)13-23(34-25(38)15-32)28(42)37-24(14-18-16-33-20-8-4-3-7-19(18)20)29(43)35-21(10-11-26(39)40)27(41)36-22(30(44)45)9-5-6-12-31/h3-4,7-8,16-17,21-24,33H,5-6,9-15,31-32H2,1-2H3,(H,34,38)(H,35,43)(H,36,41)(H,37,42)(H,39,40)(H,44,45)/t21-,22-,23-,24-/m0/s1 |
| InChIKey | VALLCCLSHDCMKE-ZJZGAYNASA-N |
| XLogP | -0.27 |
| TPSA | 258.83 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.73 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|