C17H25NO — CID 101386838
N-[(E,1R)-1-(2-methylphenyl)oct-2-enyl]acetamide (PubChem CID 101386838) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is N-[(E,1R)-1-(2-methylphenyl)oct-2-enyl]acetamide.
| Compound Name | N-[(E,1R)-1-(2-methylphenyl)oct-2-enyl]acetamide |
|---|---|
| PubChem CID | 101386838 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | N-[(E,1R)-1-(2-methylphenyl)oct-2-enyl]acetamide |
| SMILES | CCCCC/C=C/[C@@H](NC(C)=O)c1ccccc1C |
| InChI | InChI=1S/C17H25NO/c1-4-5-6-7-8-13-17(18-15(3)19)16-12-10-9-11-14(16)2/h8-13,17H,4-7H2,1-3H3,(H,18,19)/b13-8+/t17-/m1/s1 |
| InChIKey | XYEJWVMNOHROLE-MSGBMKDASA-N |
| XLogP | 4.31 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|