C22H25NO3Si — CID 101386970
(4R)-3-[(1R,2S)-1-hydroxy-1-phenyl-4-trimethylsilylbut-3-yn-2-yl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 101386970) has the molecular formula C22H25NO3Si and a molecular weight of 379.53 g/mol. Its IUPAC name is (4R)-3-[(1R,2S)-1-hydroxy-1-phenyl-4-trimethylsilylbut-3-yn-2-yl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R)-3-[(1R,2S)-1-hydroxy-1-phenyl-4-trimethylsilylbut-3-yn-2-yl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 101386970 |
| Molecular Formula | C22H25NO3Si |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | (4R)-3-[(1R,2S)-1-hydroxy-1-phenyl-4-trimethylsilylbut-3-yn-2-yl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | C[Si](C)(C)C#C[C@@H]([C@H](O)c1ccccc1)N1C(=O)OC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C22H25NO3Si/c1-27(2,3)15-14-19(21(24)18-12-8-5-9-13-18)23-20(16-26-22(23)25)17-10-6-4-7-11-17/h4-13,19-21,24H,16H2,1-3H3/t19-,20-,21+/m0/s1 |
| InChIKey | YALXEBQTLFJCHW-PCCBWWKXSA-N |
| XLogP | 4.16 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|