C20H22FNO3 — CID 141322873
(4S)-3-[(5S)-5-(4-fluorophenyl)-5-hydroxypentyl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 141322873) has the molecular formula C20H22FNO3 and a molecular weight of 343.40 g/mol. Its IUPAC name is (4S)-3-[(5S)-5-(4-fluorophenyl)-5-hydroxypentyl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(5S)-5-(4-fluorophenyl)-5-hydroxypentyl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 141322873 |
| Molecular Formula | C20H22FNO3 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | (4S)-3-[(5S)-5-(4-fluorophenyl)-5-hydroxypentyl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | O=C1OC[C@H](c2ccccc2)N1CCCC[C@H](O)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H22FNO3/c21-17-11-9-16(10-12-17)19(23)8-4-5-13-22-18(14-25-20(22)24)15-6-2-1-3-7-15/h1-3,6-7,9-12,18-19,23H,4-5,8,13-14H2/t18-,19+/m1/s1 |
| InChIKey | XLGLYKTWCUISDB-MOPGFXCFSA-N |
| XLogP | 4.22 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|