C24H40FNO4Si — CID 67028682
tert-butyl (3S)-2-(3-fluorophenyl)-2-hydroxy-3-tri(propan-2-yl)silyloxypyrrolidine-1-carboxylate (PubChem CID 67028682) has the molecular formula C24H40FNO4Si and a molecular weight of 453.67 g/mol. Its IUPAC name is tert-butyl (3S)-2-(3-fluorophenyl)-2-hydroxy-3-tri(propan-2-yl)silyloxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-2-(3-fluorophenyl)-2-hydroxy-3-tri(propan-2-yl)silyloxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 67028682 |
| Molecular Formula | C24H40FNO4Si |
| Molecular Weight | 453.67 g/mol |
| Exact Mass | 453.27 |
| IUPAC Name | tert-butyl (3S)-2-(3-fluorophenyl)-2-hydroxy-3-tri(propan-2-yl)silyloxypyrrolidine-1-carboxylate |
| SMILES | CC(C)[Si](O[C@H]1CCN(C(=O)OC(C)(C)C)C1(O)c1cccc(F)c1)(C(C)C)C(C)C |
| InChI | InChI=1S/C24H40FNO4Si/c1-16(2)31(17(3)4,18(5)6)30-21-13-14-26(22(27)29-23(7,8)9)24(21,28)19-11-10-12-20(25)15-19/h10-12,15-18,21,28H,13-14H2,1-9H3/t21-,24?/m0/s1 |
| InChIKey | XFQWWXMDKOFPMR-XEGCMXMBSA-N |
| XLogP | 6.17 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.67 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|