C24H32O2Si — CID 101388497
(4S,5E,7E)-8-[tert-butyl(dimethyl)silyl]oxy-4-naphthalen-2-ylocta-1,5,7-trien-4-ol (PubChem CID 101388497) has the molecular formula C24H32O2Si and a molecular weight of 380.60 g/mol. Its IUPAC name is (4S,5E,7E)-8-[tert-butyl(dimethyl)silyl]oxy-4-naphthalen-2-ylocta-1,5,7-trien-4-ol.
| Compound Name | (4S,5E,7E)-8-[tert-butyl(dimethyl)silyl]oxy-4-naphthalen-2-ylocta-1,5,7-trien-4-ol |
|---|---|
| PubChem CID | 101388497 |
| Molecular Formula | C24H32O2Si |
| Molecular Weight | 380.60 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | (4S,5E,7E)-8-[tert-butyl(dimethyl)silyl]oxy-4-naphthalen-2-ylocta-1,5,7-trien-4-ol |
| SMILES | C=CC[C@](O)(/C=C/C=C/O[Si](C)(C)C(C)(C)C)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H32O2Si/c1-7-16-24(25,17-10-11-18-26-27(5,6)23(2,3)4)22-15-14-20-12-8-9-13-21(20)19-22/h7-15,17-19,25H,1,16H2,2-6H3/b17-10+,18-11+/t24-/m0/s1 |
| InChIKey | SQPIUOLMXVOOLK-BBZKYDJJSA-N |
| XLogP | 6.70 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.60 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|