C18H18O3 — CID 122202564
ethyl 2-formyl-2-naphthalen-2-ylpent-4-enoate (PubChem CID 122202564) has the molecular formula C18H18O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is ethyl 2-formyl-2-naphthalen-2-ylpent-4-enoate.
| Compound Name | ethyl 2-formyl-2-naphthalen-2-ylpent-4-enoate |
|---|---|
| PubChem CID | 122202564 |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | ethyl 2-formyl-2-naphthalen-2-ylpent-4-enoate |
| SMILES | C=CCC(C=O)(C(=O)OCC)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C18H18O3/c1-3-11-18(13-19,17(20)21-4-2)16-10-9-14-7-5-6-8-15(14)12-16/h3,5-10,12-13H,1,4,11H2,2H3 |
| InChIKey | YGUONCVOZNGGQO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|