C17H20Cl3N3O3S — CID 10138942
2-[[2,2,2-trichloro-1-(cyclohexanecarbonylamino)ethyl]carbamothioylamino]benzoic acid (PubChem CID 10138942) has the molecular formula C17H20Cl3N3O3S and a molecular weight of 452.79 g/mol. Its IUPAC name is 2-[[2,2,2-trichloro-1-(cyclohexanecarbonylamino)ethyl]carbamothioylamino]benzoic acid.
| Compound Name | 2-[[2,2,2-trichloro-1-(cyclohexanecarbonylamino)ethyl]carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 10138942 |
| Molecular Formula | C17H20Cl3N3O3S |
| Molecular Weight | 452.79 g/mol |
| Exact Mass | 451.03 |
| IUPAC Name | 2-[[2,2,2-trichloro-1-(cyclohexanecarbonylamino)ethyl]carbamothioylamino]benzoic acid |
| SMILES | O=C(O)c1ccccc1NC(=S)NC(NC(=O)C1CCCCC1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C17H20Cl3N3O3S/c18-17(19,20)15(22-13(24)10-6-2-1-3-7-10)23-16(27)21-12-9-5-4-8-11(12)14(25)26/h4-5,8-10,15H,1-3,6-7H2,(H,22,24)(H,25,26)(H2,21,23,27) |
| InChIKey | UQJBICFFVPDNBV-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.79 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|