C17H17Cl6N3OS — CID 45128928
3-(2,2-dichloroethenyl)-2,2-dimethyl-N-[2,2,2-trichloro-1-[(2-chlorophenyl)carbamothioylamino]ethyl]cyclopropane-1-carboxamide (PubChem CID 45128928) has the molecular formula C17H17Cl6N3OS and a molecular weight of 524.13 g/mol. Its IUPAC name is 3-(2,2-dichloroethenyl)-2,2-dimethyl-N-[2,2,2-trichloro-1-[(2-chlorophenyl)carbamothioylamino]ethyl]cyclopropane-1-carboxamide.
| Compound Name | 3-(2,2-dichloroethenyl)-2,2-dimethyl-N-[2,2,2-trichloro-1-[(2-chlorophenyl)carbamothioylamino]ethyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 45128928 |
| Molecular Formula | C17H17Cl6N3OS |
| Molecular Weight | 524.13 g/mol |
| Exact Mass | 520.92 |
| IUPAC Name | 3-(2,2-dichloroethenyl)-2,2-dimethyl-N-[2,2,2-trichloro-1-[(2-chlorophenyl)carbamothioylamino]ethyl]cyclopropane-1-carboxamide |
| SMILES | CC1(C)C(C=C(Cl)Cl)C1C(=O)NC(NC(=S)Nc1ccccc1Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C17H17Cl6N3OS/c1-16(2)8(7-11(19)20)12(16)13(27)25-14(17(21,22)23)26-15(28)24-10-6-4-3-5-9(10)18/h3-8,12,14H,1-2H3,(H,25,27)(H2,24,26,28) |
| InChIKey | OOKZYCKPGLUEML-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.13 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|