C14H14Cl3N3O3S — CID 10158513
2-[[2,2,2-trichloro-1-(cyclopropanecarbonylamino)ethyl]carbamothioylamino]benzoic acid (PubChem CID 10158513) has the molecular formula C14H14Cl3N3O3S and a molecular weight of 410.71 g/mol. Its IUPAC name is 2-[[2,2,2-trichloro-1-(cyclopropanecarbonylamino)ethyl]carbamothioylamino]benzoic acid.
| Compound Name | 2-[[2,2,2-trichloro-1-(cyclopropanecarbonylamino)ethyl]carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 10158513 |
| Molecular Formula | C14H14Cl3N3O3S |
| Molecular Weight | 410.71 g/mol |
| Exact Mass | 408.98 |
| IUPAC Name | 2-[[2,2,2-trichloro-1-(cyclopropanecarbonylamino)ethyl]carbamothioylamino]benzoic acid |
| SMILES | O=C(O)c1ccccc1NC(=S)NC(NC(=O)C1CC1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H14Cl3N3O3S/c15-14(16,17)12(19-10(21)7-5-6-7)20-13(24)18-9-4-2-1-3-8(9)11(22)23/h1-4,7,12H,5-6H2,(H,19,21)(H,22,23)(H2,18,20,24) |
| InChIKey | KSJXLYZIYGPNKY-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.71 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|