C14H23IO — CID 101389500
2-[(Z)-5-iodopent-4-enyl]-2-methyl-3-propan-2-ylcyclopentan-1-one (PubChem CID 101389500) has the molecular formula C14H23IO and a molecular weight of 334.24 g/mol. Its IUPAC name is 2-[(Z)-5-iodopent-4-enyl]-2-methyl-3-propan-2-ylcyclopentan-1-one.
| Compound Name | 2-[(Z)-5-iodopent-4-enyl]-2-methyl-3-propan-2-ylcyclopentan-1-one |
|---|---|
| PubChem CID | 101389500 |
| Molecular Formula | C14H23IO |
| Molecular Weight | 334.24 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 2-[(Z)-5-iodopent-4-enyl]-2-methyl-3-propan-2-ylcyclopentan-1-one |
| SMILES | CC(C)C1CCC(=O)C1(C)CCC/C=C\I |
| InChI | InChI=1S/C14H23IO/c1-11(2)12-7-8-13(16)14(12,3)9-5-4-6-10-15/h6,10-12H,4-5,7-9H2,1-3H3/b10-6- |
| InChIKey | YLPDRWCBLZGXQS-POHAHGRESA-N |
| XLogP | 4.75 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.24 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|