C22H38O4 — CID 54382796
2-hydroxy-7-[(1R,2R)-1-methyl-2-(3-methyloct-1-enyl)-5-oxocyclopentyl]heptanoic acid (PubChem CID 54382796) has the molecular formula C22H38O4 and a molecular weight of 366.54 g/mol. Its IUPAC name is 2-hydroxy-7-[(1R,2R)-1-methyl-2-(3-methyloct-1-enyl)-5-oxocyclopentyl]heptanoic acid.
| Compound Name | 2-hydroxy-7-[(1R,2R)-1-methyl-2-(3-methyloct-1-enyl)-5-oxocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 54382796 |
| Molecular Formula | C22H38O4 |
| Molecular Weight | 366.54 g/mol |
| Exact Mass | 366.28 |
| IUPAC Name | 2-hydroxy-7-[(1R,2R)-1-methyl-2-(3-methyloct-1-enyl)-5-oxocyclopentyl]heptanoic acid |
| SMILES | CCCCCC(C)C=C[C@H]1CCC(=O)[C@]1(C)CCCCCC(O)C(=O)O |
| InChI | InChI=1S/C22H38O4/c1-4-5-7-10-17(2)12-13-18-14-15-20(24)22(18,3)16-9-6-8-11-19(23)21(25)26/h12-13,17-19,23H,4-11,14-16H2,1-3H3,(H,25,26)/t17?,18-,19?,22+/m0/s1 |
| InChIKey | VBCYPLFIVMJIMY-LAKQMRRBSA-N |
| XLogP | 5.14 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.54 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|