C24H40O4 — CID 57209542
2-ethyl-2-hydroxy-7-[(1R,2S)-1-methyl-2-(3-methyloct-1-enyl)-5-oxocyclopent-3-en-1-yl]heptanoic acid (PubChem CID 57209542) has the molecular formula C24H40O4 and a molecular weight of 392.58 g/mol. Its IUPAC name is 2-ethyl-2-hydroxy-7-[(1R,2S)-1-methyl-2-(3-methyloct-1-enyl)-5-oxocyclopent-3-en-1-yl]heptanoic acid.
| Compound Name | 2-ethyl-2-hydroxy-7-[(1R,2S)-1-methyl-2-(3-methyloct-1-enyl)-5-oxocyclopent-3-en-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 57209542 |
| Molecular Formula | C24H40O4 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | 2-ethyl-2-hydroxy-7-[(1R,2S)-1-methyl-2-(3-methyloct-1-enyl)-5-oxocyclopent-3-en-1-yl]heptanoic acid |
| SMILES | CCCCCC(C)C=C[C@H]1C=CC(=O)[C@]1(C)CCCCCC(O)(CC)C(=O)O |
| InChI | InChI=1S/C24H40O4/c1-5-7-9-12-19(3)13-14-20-15-16-21(25)23(20,4)17-10-8-11-18-24(28,6-2)22(26)27/h13-16,19-20,28H,5-12,17-18H2,1-4H3,(H,26,27)/t19?,20-,23+,24?/m0/s1 |
| InChIKey | MTHOSPDIIKRXOG-JYOBVWHVSA-N |
| XLogP | 5.70 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|