C25H43FO4 — CID 88728268
ethyl 2-fluoro-7-[(1S,2R)-2-(3-hydroxy-5,5-dimethyloct-1-enyl)-1-methyl-5-oxocyclopentyl]heptanoate (PubChem CID 88728268) has the molecular formula C25H43FO4 and a molecular weight of 426.61 g/mol. Its IUPAC name is ethyl 2-fluoro-7-[(1S,2R)-2-(3-hydroxy-5,5-dimethyloct-1-enyl)-1-methyl-5-oxocyclopentyl]heptanoate.
| Compound Name | ethyl 2-fluoro-7-[(1S,2R)-2-(3-hydroxy-5,5-dimethyloct-1-enyl)-1-methyl-5-oxocyclopentyl]heptanoate |
|---|---|
| PubChem CID | 88728268 |
| Molecular Formula | C25H43FO4 |
| Molecular Weight | 426.61 g/mol |
| Exact Mass | 426.31 |
| IUPAC Name | ethyl 2-fluoro-7-[(1S,2R)-2-(3-hydroxy-5,5-dimethyloct-1-enyl)-1-methyl-5-oxocyclopentyl]heptanoate |
| SMILES | CCCC(C)(C)CC(O)C=C[C@H]1CCC(=O)[C@@]1(C)CCCCCC(F)C(=O)OCC |
| InChI | InChI=1S/C25H43FO4/c1-6-16-24(3,4)18-20(27)14-12-19-13-15-22(28)25(19,5)17-10-8-9-11-21(26)23(29)30-7-2/h12,14,19-21,27H,6-11,13,15-18H2,1-5H3/t19-,20?,21?,25-/m0/s1 |
| InChIKey | JHVNPXRSSQHFKY-YPSOBGEZSA-N |
| XLogP | 5.96 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.61 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|