C26H44O6 — CID 70628704
cis-ethyl (1R,2R)-1-(7-ethoxy-2-methyl-7-oxoheptyl)-2-(3-hydroxyoct-1-enyl)-5-oxocyclopentane-1-carboxylate (PubChem CID 70628704) has the molecular formula C26H44O6 and a molecular weight of 452.63 g/mol. Its IUPAC name is cis-ethyl (1R,2R)-1-(7-ethoxy-2-methyl-7-oxoheptyl)-2-(3-hydroxyoct-1-enyl)-5-oxocyclopentane-1-carboxylate.
| Compound Name | cis-ethyl (1R,2R)-1-(7-ethoxy-2-methyl-7-oxoheptyl)-2-(3-hydroxyoct-1-enyl)-5-oxocyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 70628704 |
| Molecular Formula | C26H44O6 |
| Molecular Weight | 452.63 g/mol |
| Exact Mass | 452.31 |
| IUPAC Name | cis-ethyl (1R,2R)-1-(7-ethoxy-2-methyl-7-oxoheptyl)-2-(3-hydroxyoct-1-enyl)-5-oxocyclopentane-1-carboxylate |
| SMILES | CCCCCC(O)C=C[C@H]1CCC(=O)[C@]1(CC(C)CCCCC(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C26H44O6/c1-5-8-9-13-22(27)17-15-21-16-18-23(28)26(21,25(30)32-7-3)19-20(4)12-10-11-14-24(29)31-6-2/h15,17,20-22,27H,5-14,16,18-19H2,1-4H3/t20?,21-,22?,26+/m0/s1 |
| InChIKey | VDICURNUNIVKGK-LMBUJBDKSA-N |
| XLogP | 5.16 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.63 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|