C33H48O7 — CID 70616306
ethyl 1-(7-ethoxy-7-oxoheptyl)-2-oxo-5-(3-phenacyloctanoyl)cyclopentane-1-carboxylate (PubChem CID 70616306) has the molecular formula C33H48O7 and a molecular weight of 556.74 g/mol. Its IUPAC name is ethyl 1-(7-ethoxy-7-oxoheptyl)-2-oxo-5-(3-phenacyloctanoyl)cyclopentane-1-carboxylate.
| Compound Name | ethyl 1-(7-ethoxy-7-oxoheptyl)-2-oxo-5-(3-phenacyloctanoyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 70616306 |
| Molecular Formula | C33H48O7 |
| Molecular Weight | 556.74 g/mol |
| Exact Mass | 556.34 |
| IUPAC Name | ethyl 1-(7-ethoxy-7-oxoheptyl)-2-oxo-5-(3-phenacyloctanoyl)cyclopentane-1-carboxylate |
| SMILES | CCCCCC(CC(=O)c1ccccc1)CC(=O)C1CCC(=O)C1(CCCCCCC(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C33H48O7/c1-4-7-11-16-25(23-28(34)26-17-12-10-13-18-26)24-29(35)27-20-21-30(36)33(27,32(38)40-6-3)22-15-9-8-14-19-31(37)39-5-2/h10,12-13,17-18,25,27H,4-9,11,14-16,19-24H2,1-3H3 |
| InChIKey | LXTHXNXXJWODFR-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.74 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|