C32H48O6 — CID 70616992
ethyl 1-[(Z)-7-ethoxy-7-oxohept-2-enyl]-2-oxo-5-(3-phenylmethoxyoctyl)cyclopentane-1-carboxylate (PubChem CID 70616992) has the molecular formula C32H48O6 and a molecular weight of 528.73 g/mol. Its IUPAC name is ethyl 1-[(Z)-7-ethoxy-7-oxohept-2-enyl]-2-oxo-5-(3-phenylmethoxyoctyl)cyclopentane-1-carboxylate.
| Compound Name | ethyl 1-[(Z)-7-ethoxy-7-oxohept-2-enyl]-2-oxo-5-(3-phenylmethoxyoctyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 70616992 |
| Molecular Formula | C32H48O6 |
| Molecular Weight | 528.73 g/mol |
| Exact Mass | 528.35 |
| IUPAC Name | ethyl 1-[(Z)-7-ethoxy-7-oxohept-2-enyl]-2-oxo-5-(3-phenylmethoxyoctyl)cyclopentane-1-carboxylate |
| SMILES | CCCCCC(CCC1CCC(=O)C1(C/C=C\CCCC(=O)OCC)C(=O)OCC)OCc1ccccc1 |
| InChI | InChI=1S/C32H48O6/c1-4-7-11-18-28(38-25-26-16-12-10-13-17-26)22-20-27-21-23-29(33)32(27,31(35)37-6-3)24-15-9-8-14-19-30(34)36-5-2/h9-10,12-13,15-17,27-28H,4-8,11,14,18-25H2,1-3H3/b15-9- |
| InChIKey | DLRLCVORCXNSHY-DHDCSXOGSA-N |
| XLogP | 7.14 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.73 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|