C28H48O6 — CID 70616986
ethyl 1-(7-ethoxy-7-oxoheptyl)-2-oxo-5-(3-prop-2-enoxyoctyl)cyclopentane-1-carboxylate (PubChem CID 70616986) has the molecular formula C28H48O6 and a molecular weight of 480.69 g/mol. Its IUPAC name is ethyl 1-(7-ethoxy-7-oxoheptyl)-2-oxo-5-(3-prop-2-enoxyoctyl)cyclopentane-1-carboxylate.
| Compound Name | ethyl 1-(7-ethoxy-7-oxoheptyl)-2-oxo-5-(3-prop-2-enoxyoctyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 70616986 |
| Molecular Formula | C28H48O6 |
| Molecular Weight | 480.69 g/mol |
| Exact Mass | 480.35 |
| IUPAC Name | ethyl 1-(7-ethoxy-7-oxoheptyl)-2-oxo-5-(3-prop-2-enoxyoctyl)cyclopentane-1-carboxylate |
| SMILES | C=CCOC(CCCCC)CCC1CCC(=O)C1(CCCCCCC(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C28H48O6/c1-5-9-12-15-24(34-22-6-2)19-17-23-18-20-25(29)28(23,27(31)33-8-4)21-14-11-10-13-16-26(30)32-7-3/h6,23-24H,2,5,7-22H2,1,3-4H3 |
| InChIKey | VUPNVFFHMODRNO-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.69 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|