C27H46O6 — CID 70628219
cis-ethyl (1R,2R)-1-(7-ethoxy-3-ethyl-7-oxoheptyl)-2-(3-hydroxyoct-1-enyl)-5-oxocyclopentane-1-carboxylate (PubChem CID 70628219) has the molecular formula C27H46O6 and a molecular weight of 466.66 g/mol. Its IUPAC name is cis-ethyl (1R,2R)-1-(7-ethoxy-3-ethyl-7-oxoheptyl)-2-(3-hydroxyoct-1-enyl)-5-oxocyclopentane-1-carboxylate.
| Compound Name | cis-ethyl (1R,2R)-1-(7-ethoxy-3-ethyl-7-oxoheptyl)-2-(3-hydroxyoct-1-enyl)-5-oxocyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 70628219 |
| Molecular Formula | C27H46O6 |
| Molecular Weight | 466.66 g/mol |
| Exact Mass | 466.33 |
| IUPAC Name | cis-ethyl (1R,2R)-1-(7-ethoxy-3-ethyl-7-oxoheptyl)-2-(3-hydroxyoct-1-enyl)-5-oxocyclopentane-1-carboxylate |
| SMILES | CCCCCC(O)C=C[C@H]1CCC(=O)[C@]1(CCC(CC)CCCC(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C27H46O6/c1-5-9-10-13-23(28)17-15-22-16-18-24(29)27(22,26(31)33-8-4)20-19-21(6-2)12-11-14-25(30)32-7-3/h15,17,21-23,28H,5-14,16,18-20H2,1-4H3/t21?,22-,23?,27+/m0/s1 |
| InChIKey | MMVSQHOCRBTPEK-BGCDZSTMSA-N |
| XLogP | 5.55 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.66 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|