C32H50O8 — CID 70628463
cis-ethyl (1R,2R)-2-[3-(4-cyclopentylbutanoyloxy)oct-1-enyl]-1-[(E)-4-(2-methoxy-2-oxoethoxy)but-2-enyl]-5-oxocyclopentane-1-carboxylate (PubChem CID 70628463) has the molecular formula C32H50O8 and a molecular weight of 562.74 g/mol. Its IUPAC name is cis-ethyl (1R,2R)-2-[3-(4-cyclopentylbutanoyloxy)oct-1-enyl]-1-[(E)-4-(2-methoxy-2-oxoethoxy)but-2-enyl]-5-oxocyclopentane-1-carboxylate.
| Compound Name | cis-ethyl (1R,2R)-2-[3-(4-cyclopentylbutanoyloxy)oct-1-enyl]-1-[(E)-4-(2-methoxy-2-oxoethoxy)but-2-enyl]-5-oxocyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 70628463 |
| Molecular Formula | C32H50O8 |
| Molecular Weight | 562.74 g/mol |
| Exact Mass | 562.35 |
| IUPAC Name | cis-ethyl (1R,2R)-2-[3-(4-cyclopentylbutanoyloxy)oct-1-enyl]-1-[(E)-4-(2-methoxy-2-oxoethoxy)but-2-enyl]-5-oxocyclopentane-1-carboxylate |
| SMILES | CCCCCC(C=C[C@H]1CCC(=O)[C@]1(C/C=C/COCC(=O)OC)C(=O)OCC)OC(=O)CCCC1CCCC1 |
| InChI | InChI=1S/C32H50O8/c1-4-6-7-16-27(40-29(34)17-12-15-25-13-8-9-14-25)20-18-26-19-21-28(33)32(26,31(36)39-5-2)22-10-11-23-38-24-30(35)37-3/h10-11,18,20,25-27H,4-9,12-17,19,21-24H2,1-3H3/b11-10+,20-18?/t26-,27?,32+/m0/s1 |
| InChIKey | MUIPDHRHMQXCAR-WMISMNKSSA-N |
| XLogP | 6.06 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.74 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|