C21H36O4 — CID 54549087
2-hydroxy-7-[(1R)-1-methyl-2-octyl-5-oxocyclopent-2-en-1-yl]heptanoic acid (PubChem CID 54549087) has the molecular formula C21H36O4 and a molecular weight of 352.52 g/mol. Its IUPAC name is 2-hydroxy-7-[(1R)-1-methyl-2-octyl-5-oxocyclopent-2-en-1-yl]heptanoic acid.
| Compound Name | 2-hydroxy-7-[(1R)-1-methyl-2-octyl-5-oxocyclopent-2-en-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 54549087 |
| Molecular Formula | C21H36O4 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.26 |
| IUPAC Name | 2-hydroxy-7-[(1R)-1-methyl-2-octyl-5-oxocyclopent-2-en-1-yl]heptanoic acid |
| SMILES | CCCCCCCCC1=CCC(=O)[C@]1(C)CCCCCC(O)C(=O)O |
| InChI | InChI=1S/C21H36O4/c1-3-4-5-6-7-9-12-17-14-15-19(23)21(17,2)16-11-8-10-13-18(22)20(24)25/h14,18,22H,3-13,15-16H2,1-2H3,(H,24,25)/t18?,21-/m1/s1 |
| InChIKey | ZIQJVKMAFMZAKR-BDPMCISCSA-N |
| XLogP | 5.04 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|