C34H39N7O10 — CID 101390689
2-[bis[2-[carboxymethyl-[2-[(4-methyl-2-oxo-1H-quinolin-7-yl)amino]-2-oxoethyl]amino]ethyl]amino]acetic acid (PubChem CID 101390689) has the molecular formula C34H39N7O10 and a molecular weight of 705.73 g/mol. Its IUPAC name is 2-[bis[2-[carboxymethyl-[2-[(4-methyl-2-oxo-1H-quinolin-7-yl)amino]-2-oxoethyl]amino]ethyl]amino]acetic acid.
| Compound Name | 2-[bis[2-[carboxymethyl-[2-[(4-methyl-2-oxo-1H-quinolin-7-yl)amino]-2-oxoethyl]amino]ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 101390689 |
| Molecular Formula | C34H39N7O10 |
| Molecular Weight | 705.73 g/mol |
| Exact Mass | 705.28 |
| IUPAC Name | 2-[bis[2-[carboxymethyl-[2-[(4-methyl-2-oxo-1H-quinolin-7-yl)amino]-2-oxoethyl]amino]ethyl]amino]acetic acid |
| SMILES | Cc1cc(=O)[nH]c2cc(NC(=O)CN(CCN(CCN(CC(=O)O)CC(=O)Nc3ccc4c(C)cc(=O)[nH]c4c3)CC(=O)O)CC(=O)O)ccc12 |
| InChI | InChI=1S/C34H39N7O10/c1-20-11-28(42)37-26-13-22(3-5-24(20)26)35-30(44)15-40(18-33(48)49)9-7-39(17-32(46)47)8-10-41(19-34(50)51)16-31(45)36-23-4-6-25-21(2)12-29(43)38-27(25)14-23/h3-6,11-14H,7-10,15-19H2,1-2H3,(H,35,44)(H,36,45)(H,37,42)(H,38,43)(H,46,47)(H,48,49)(H,50,51) |
| InChIKey | NFRWQIQZNGSFNX-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 245.54 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.73 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |