C32H33N5O12 — CID 102234883
2-[bis[2-[carboxymethyl-[2-oxo-2-[(2-oxochromen-6-yl)amino]ethyl]amino]ethyl]amino]acetic acid (PubChem CID 102234883) has the molecular formula C32H33N5O12 and a molecular weight of 679.64 g/mol. Its IUPAC name is 2-[bis[2-[carboxymethyl-[2-oxo-2-[(2-oxochromen-6-yl)amino]ethyl]amino]ethyl]amino]acetic acid.
| Compound Name | 2-[bis[2-[carboxymethyl-[2-oxo-2-[(2-oxochromen-6-yl)amino]ethyl]amino]ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 102234883 |
| Molecular Formula | C32H33N5O12 |
| Molecular Weight | 679.64 g/mol |
| Exact Mass | 679.21 |
| IUPAC Name | 2-[bis[2-[carboxymethyl-[2-oxo-2-[(2-oxochromen-6-yl)amino]ethyl]amino]ethyl]amino]acetic acid |
| SMILES | O=C(O)CN(CCN(CC(=O)O)CC(=O)Nc1ccc2oc(=O)ccc2c1)CCN(CC(=O)O)CC(=O)Nc1ccc2oc(=O)ccc2c1 |
| InChI | InChI=1S/C32H33N5O12/c38-26(33-22-3-5-24-20(13-22)1-7-31(46)48-24)15-36(18-29(42)43)11-9-35(17-28(40)41)10-12-37(19-30(44)45)16-27(39)34-23-4-6-25-21(14-23)2-8-32(47)49-25/h1-8,13-14H,9-12,15-19H2,(H,33,38)(H,34,39)(H,40,41)(H,42,43)(H,44,45) |
| InChIKey | PMSAZEOCLIQVPE-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 240.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.64 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|