C19H16ClNO4 — CID 40617668
2-(4-chloro-3,5-dimethylphenoxy)-N-(2-oxochromen-6-yl)acetamide (PubChem CID 40617668) has the molecular formula C19H16ClNO4 and a molecular weight of 357.79 g/mol. Its IUPAC name is 2-(4-chloro-3,5-dimethylphenoxy)-N-(2-oxochromen-6-yl)acetamide.
| Compound Name | 2-(4-chloro-3,5-dimethylphenoxy)-N-(2-oxochromen-6-yl)acetamide |
|---|---|
| PubChem CID | 40617668 |
| Molecular Formula | C19H16ClNO4 |
| Molecular Weight | 357.79 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | 2-(4-chloro-3,5-dimethylphenoxy)-N-(2-oxochromen-6-yl)acetamide |
| SMILES | Cc1cc(OCC(=O)Nc2ccc3oc(=O)ccc3c2)cc(C)c1Cl |
| InChI | InChI=1S/C19H16ClNO4/c1-11-7-15(8-12(2)19(11)20)24-10-17(22)21-14-4-5-16-13(9-14)3-6-18(23)25-16/h3-9H,10H2,1-2H3,(H,21,22) |
| InChIKey | GYKBQYAKHAWOGQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.79 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|