C14H15NO5 — CID 60580990
2-(2-methoxyethoxy)-N-(2-oxochromen-6-yl)acetamide (PubChem CID 60580990) has the molecular formula C14H15NO5 and a molecular weight of 277.28 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)-N-(2-oxochromen-6-yl)acetamide.
| Compound Name | 2-(2-methoxyethoxy)-N-(2-oxochromen-6-yl)acetamide |
|---|---|
| PubChem CID | 60580990 |
| Molecular Formula | C14H15NO5 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 2-(2-methoxyethoxy)-N-(2-oxochromen-6-yl)acetamide |
| SMILES | COCCOCC(=O)Nc1ccc2oc(=O)ccc2c1 |
| InChI | InChI=1S/C14H15NO5/c1-18-6-7-19-9-13(16)15-11-3-4-12-10(8-11)2-5-14(17)20-12/h2-5,8H,6-7,9H2,1H3,(H,15,16) |
| InChIKey | CNOQQFUGZLQJEM-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|