C9H11F5OS — CID 101391813
1-[(1S,2S,3R,4R)-3-(pentafluoro-λ6-sulfanyl)-2-bicyclo[2.2.1]hept-5-enyl]ethanone (PubChem CID 101391813) has the molecular formula C9H11F5OS and a molecular weight of 262.24 g/mol. Its IUPAC name is 1-[(1S,2S,3R,4R)-3-(pentafluoro-λ6-sulfanyl)-2-bicyclo[2.2.1]hept-5-enyl]ethanone.
| Compound Name | 1-[(1S,2S,3R,4R)-3-(pentafluoro-λ6-sulfanyl)-2-bicyclo[2.2.1]hept-5-enyl]ethanone |
|---|---|
| PubChem CID | 101391813 |
| Molecular Formula | C9H11F5OS |
| Molecular Weight | 262.24 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | 1-[(1S,2S,3R,4R)-3-(pentafluoro-λ6-sulfanyl)-2-bicyclo[2.2.1]hept-5-enyl]ethanone |
| SMILES | CC(=O)[C@H]1[C@H](S(F)(F)(F)(F)F)[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C9H11F5OS/c1-5(15)8-6-2-3-7(4-6)9(8)16(10,11,12,13)14/h2-3,6-9H,4H2,1H3/t6-,7+,8-,9-/m1/s1 |
| InChIKey | VHWYPASVURRPFN-BZNPZCIMSA-N |
| XLogP | 4.06 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.24 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|