C26H52OSi4 — CID 101392211
[6-(1-adamantyl)-3,4-dimethyl-1,1-bis(trimethylsilyl)-2,5-dihydrosilin-6-yl]oxy-trimethylsilane (PubChem CID 101392211) has the molecular formula C26H52OSi4 and a molecular weight of 493.05 g/mol. Its IUPAC name is [6-(1-adamantyl)-3,4-dimethyl-1,1-bis(trimethylsilyl)-2,5-dihydrosilin-6-yl]oxy-trimethylsilane.
| Compound Name | [6-(1-adamantyl)-3,4-dimethyl-1,1-bis(trimethylsilyl)-2,5-dihydrosilin-6-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 101392211 |
| Molecular Formula | C26H52OSi4 |
| Molecular Weight | 493.05 g/mol |
| Exact Mass | 492.31 |
| IUPAC Name | [6-(1-adamantyl)-3,4-dimethyl-1,1-bis(trimethylsilyl)-2,5-dihydrosilin-6-yl]oxy-trimethylsilane |
| SMILES | CC1=C(C)C[Si]([Si](C)(C)C)([Si](C)(C)C)C(O[Si](C)(C)C)(C23CC4CC(CC(C4)C2)C3)C1 |
| InChI | InChI=1S/C26H52OSi4/c1-20-15-26(27-28(3,4)5,25-16-22-12-23(17-25)14-24(13-22)18-25)31(19-21(20)2,29(6,7)8)30(9,10)11/h22-24H,12-19H2,1-11H3 |
| InChIKey | JTVBVAYNQMLGRB-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.05 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|