C10H17NO2 — CID 101392583
ethyl (2R,3S)-3-but-3-en-2-yl-3-methylaziridine-2-carboxylate (PubChem CID 101392583) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is ethyl (2R,3S)-3-but-3-en-2-yl-3-methylaziridine-2-carboxylate.
| Compound Name | ethyl (2R,3S)-3-but-3-en-2-yl-3-methylaziridine-2-carboxylate |
|---|---|
| PubChem CID | 101392583 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | ethyl (2R,3S)-3-but-3-en-2-yl-3-methylaziridine-2-carboxylate |
| SMILES | C=CC(C)[C@]1(C)N[C@H]1C(=O)OCC |
| InChI | InChI=1S/C10H17NO2/c1-5-7(3)10(4)8(11-10)9(12)13-6-2/h5,7-8,11H,1,6H2,2-4H3/t7?,8-,10-/m0/s1 |
| InChIKey | UMVJAIHESVIEDX-CFGJQEBVSA-N |
| XLogP | 1.10 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|