C8H14N2O3 — CID 134876877
ethyl (3S)-4,4-dimethyl-5-oxopyrazolidine-3-carboxylate (PubChem CID 134876877) has the molecular formula C8H14N2O3 and a molecular weight of 186.21 g/mol. Its IUPAC name is ethyl (3S)-4,4-dimethyl-5-oxopyrazolidine-3-carboxylate.
| Compound Name | ethyl (3S)-4,4-dimethyl-5-oxopyrazolidine-3-carboxylate |
|---|---|
| PubChem CID | 134876877 |
| Molecular Formula | C8H14N2O3 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | ethyl (3S)-4,4-dimethyl-5-oxopyrazolidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1NNC(=O)C1(C)C |
| InChI | InChI=1S/C8H14N2O3/c1-4-13-6(11)5-8(2,3)7(12)10-9-5/h5,9H,4H2,1-3H3,(H,10,12)/t5-/m1/s1 |
| InChIKey | DHHUUVHEIWLBCS-RXMQYKEDSA-N |
| XLogP | -0.42 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |