C42H50N2O12 — CID 101393556
[6-[4-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]butylamino]-6-oxohexyl] 2,5-bis[(4-butoxybenzoyl)oxy]benzoate (PubChem CID 101393556) has the molecular formula C42H50N2O12 and a molecular weight of 774.86 g/mol. Its IUPAC name is [6-[4-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]butylamino]-6-oxohexyl] 2,5-bis[(4-butoxybenzoyl)oxy]benzoate.
| Compound Name | [6-[4-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]butylamino]-6-oxohexyl] 2,5-bis[(4-butoxybenzoyl)oxy]benzoate |
|---|---|
| PubChem CID | 101393556 |
| Molecular Formula | C42H50N2O12 |
| Molecular Weight | 774.86 g/mol |
| Exact Mass | 774.34 |
| IUPAC Name | [6-[4-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]butylamino]-6-oxohexyl] 2,5-bis[(4-butoxybenzoyl)oxy]benzoate |
| SMILES | CCCCOc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(OCCCC)cc3)c(C(=O)OCCCCCC(=O)NCCCC[C@@H]3NC(=O)OC3=O)c2)cc1 |
| InChI | InChI=1S/C42H50N2O12/c1-3-5-25-51-31-18-14-29(15-19-31)38(46)54-33-22-23-36(55-39(47)30-16-20-32(21-17-30)52-26-6-4-2)34(28-33)40(48)53-27-11-7-8-13-37(45)43-24-10-9-12-35-41(49)56-42(50)44-35/h14-23,28,35H,3-13,24-27H2,1-2H3,(H,43,45)(H,44,50)/t35-/m0/s1 |
| InChIKey | MKOAZPLRIODDCO-DHUJRADRSA-N |
| XLogP | 7.12 |
| TPSA | 181.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.86 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|