C25H19BrN2O2 — CID 10139366
3-[(4-bromophenyl)methyl]-1-methyl-6-(3-phenylprop-1-ynyl)quinazoline-2,4-dione (PubChem CID 10139366) has the molecular formula C25H19BrN2O2 and a molecular weight of 459.34 g/mol. Its IUPAC name is 3-[(4-bromophenyl)methyl]-1-methyl-6-(3-phenylprop-1-ynyl)quinazoline-2,4-dione.
| Compound Name | 3-[(4-bromophenyl)methyl]-1-methyl-6-(3-phenylprop-1-ynyl)quinazoline-2,4-dione |
|---|---|
| PubChem CID | 10139366 |
| Molecular Formula | C25H19BrN2O2 |
| Molecular Weight | 459.34 g/mol |
| Exact Mass | 458.06 |
| IUPAC Name | 3-[(4-bromophenyl)methyl]-1-methyl-6-(3-phenylprop-1-ynyl)quinazoline-2,4-dione |
| SMILES | Cn1c(=O)n(Cc2ccc(Br)cc2)c(=O)c2cc(C#CCc3ccccc3)ccc21 |
| InChI | InChI=1S/C25H19BrN2O2/c1-27-23-15-12-19(9-5-8-18-6-3-2-4-7-18)16-22(23)24(29)28(25(27)30)17-20-10-13-21(26)14-11-20/h2-4,6-7,10-16H,8,17H2,1H3 |
| InChIKey | FMBILMWLDVZGCS-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.34 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|