C18H30O3 — CID 101394433
[(3aR,6aR,7S,9aS,9bR)-2,2,9a-trimethyl-7-propan-2-yl-4,6a,7,8,9,9b-hexahydro-3aH-azuleno[4,5-d][1,3]dioxol-5-yl]methanol (PubChem CID 101394433) has the molecular formula C18H30O3 and a molecular weight of 294.44 g/mol. Its IUPAC name is [(3aR,6aR,7S,9aS,9bR)-2,2,9a-trimethyl-7-propan-2-yl-4,6a,7,8,9,9b-hexahydro-3aH-azuleno[4,5-d][1,3]dioxol-5-yl]methanol.
| Compound Name | [(3aR,6aR,7S,9aS,9bR)-2,2,9a-trimethyl-7-propan-2-yl-4,6a,7,8,9,9b-hexahydro-3aH-azuleno[4,5-d][1,3]dioxol-5-yl]methanol |
|---|---|
| PubChem CID | 101394433 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | [(3aR,6aR,7S,9aS,9bR)-2,2,9a-trimethyl-7-propan-2-yl-4,6a,7,8,9,9b-hexahydro-3aH-azuleno[4,5-d][1,3]dioxol-5-yl]methanol |
| SMILES | CC(C)[C@@H]1CC[C@@]2(C)[C@H]1C=C(CO)C[C@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C18H30O3/c1-11(2)13-6-7-18(5)14(13)8-12(10-19)9-15-16(18)21-17(3,4)20-15/h8,11,13-16,19H,6-7,9-10H2,1-5H3/t13-,14-,15+,16-,18-/m0/s1 |
| InChIKey | NRNQVCNAWNDYOT-RPUYLAQPSA-N |
| XLogP | 3.52 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|