C12H17NO5 — CID 101394621
(3S,4S,7S,10S)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,6-dioxa-1-azatricyclo[5.2.1.04,10]decan-5-one (PubChem CID 101394621) has the molecular formula C12H17NO5 and a molecular weight of 255.27 g/mol. Its IUPAC name is (3S,4S,7S,10S)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,6-dioxa-1-azatricyclo[5.2.1.04,10]decan-5-one.
| Compound Name | (3S,4S,7S,10S)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,6-dioxa-1-azatricyclo[5.2.1.04,10]decan-5-one |
|---|---|
| PubChem CID | 101394621 |
| Molecular Formula | C12H17NO5 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | (3S,4S,7S,10S)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,6-dioxa-1-azatricyclo[5.2.1.04,10]decan-5-one |
| SMILES | CC1(C)OC[C@H]([C@H]2ON3CC[C@@H]4OC(=O)[C@H]2[C@@H]43)O1 |
| InChI | InChI=1S/C12H17NO5/c1-12(2)15-5-7(17-12)10-8-9-6(16-11(8)14)3-4-13(9)18-10/h6-10H,3-5H2,1-2H3/t6-,7+,8-,9+,10+/m0/s1 |
| InChIKey | JBXWLRVGZQMXJB-SQXHDICFSA-N |
| XLogP | 0.07 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |