C15H18O6 — CID 11323854
(3S,3aS,5aR,8aR,8bS)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,3a,5a,6,8a,8b-hexahydrofuro[3,4-g][2]benzofuran-1,8-dione (PubChem CID 11323854) has the molecular formula C15H18O6 and a molecular weight of 294.30 g/mol. Its IUPAC name is (3S,3aS,5aR,8aR,8bS)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,3a,5a,6,8a,8b-hexahydrofuro[3,4-g][2]benzofuran-1,8-dione.
| Compound Name | (3S,3aS,5aR,8aR,8bS)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,3a,5a,6,8a,8b-hexahydrofuro[3,4-g][2]benzofuran-1,8-dione |
|---|---|
| PubChem CID | 11323854 |
| Molecular Formula | C15H18O6 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | (3S,3aS,5aR,8aR,8bS)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,3a,5a,6,8a,8b-hexahydrofuro[3,4-g][2]benzofuran-1,8-dione |
| SMILES | CC1(C)OC[C@H]([C@H]2OC(=O)[C@H]3[C@@H]2C=C[C@H]2COC(=O)[C@@H]32)O1 |
| InChI | InChI=1S/C15H18O6/c1-15(2)19-6-9(21-15)12-8-4-3-7-5-18-13(16)10(7)11(8)14(17)20-12/h3-4,7-12H,5-6H2,1-2H3/t7-,8-,9+,10+,11-,12-/m0/s1 |
| InChIKey | FSYHHZOTUWLCQL-URIQBSJHSA-N |
| XLogP | 0.65 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|