C10H8O6-2 — CID 101397559
(3R,6R)-3-(2-carboxylato-2-oxoethyl)-6-deuterio-6-hydroxycyclohexa-1,4-diene-1-carboxylate (PubChem CID 101397559) has the molecular formula C10H8O6-2 and a molecular weight of 225.17 g/mol. Its IUPAC name is (3R,6R)-3-(2-carboxylato-2-oxoethyl)-6-deuterio-6-hydroxycyclohexa-1,4-diene-1-carboxylate.
| Compound Name | (3R,6R)-3-(2-carboxylato-2-oxoethyl)-6-deuterio-6-hydroxycyclohexa-1,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 101397559 |
| Molecular Formula | C10H8O6-2 |
| Molecular Weight | 225.17 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | (3R,6R)-3-(2-carboxylato-2-oxoethyl)-6-deuterio-6-hydroxycyclohexa-1,4-diene-1-carboxylate |
| SMILES | [2H][C@@]1(O)C=C[C@@H](CC(=O)C(=O)[O-])C=C1C(=O)[O-] |
| InChI | InChI=1S/C10H10O6/c11-7-2-1-5(3-6(7)9(13)14)4-8(12)10(15)16/h1-3,5,7,11H,4H2,(H,13,14)(H,15,16)/p-2/t5-,7-/m1/s1/i7D |
| InChIKey | SXJNLLYIBUOSIH-PUMFJGNWSA-L |
| XLogP | -3.08 |
| TPSA | 117.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.17 |
| LogP ≤ 5 | -3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|