About 6-hydroxy-5-oxocyclohexa-1,3-diene-1-carboxylic acid
6-hydroxy-5-oxocyclohexa-1,3-diene-1-carboxylic acid (PubChem CID 141303388) has the molecular formula C7H6O4
and a molecular weight of 154.12 g/mol. Its IUPAC name is 6-hydroxy-5-oxocyclohexa-1,3-diene-1-carboxylic acid.
Analyze 6-hydroxy-5-oxocyclohexa-1,3-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-5-oxocyclohexa-1,3-diene-1-carboxylic acid?
The IUPAC name of 6-hydroxy-5-oxocyclohexa-1,3-diene-1-carboxylic acid (CID 141303388) is 6-hydroxy-5-oxocyclohexa-1,3-diene-1-carboxylic acid.
What is the SMILES notation for 6-hydroxy-5-oxocyclohexa-1,3-diene-1-carboxylic acid?
The canonical SMILES for 6-hydroxy-5-oxocyclohexa-1,3-diene-1-carboxylic acid is O=C(O)C1=CC=CC(=O)C1O.
What is the InChIKey of 6-hydroxy-5-oxocyclohexa-1,3-diene-1-carboxylic acid?
The InChIKey is OUUIYRZOGHXKQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O4/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3,6,9H,(H,10,11).
What are the key properties of 6-hydroxy-5-oxocyclohexa-1,3-diene-1-carboxylic acid?
6-hydroxy-5-oxocyclohexa-1,3-diene-1-carboxylic acid has a molecular weight of 154.12 g/mol, XLogP of -0.50, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-5-oxocyclohexa-1,3-diene-1-carboxylic acid is sourced from PubChem (CID 141303388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).