C18H23NaO3S — CID 101397592
sodium 1,5-bis(2-methylpropyl)naphthalene-2-sulfonate (PubChem CID 101397592) has the molecular formula C18H23NaO3S and a molecular weight of 342.44 g/mol. Its IUPAC name is sodium 1,5-bis(2-methylpropyl)naphthalene-2-sulfonate.
| Compound Name | sodium 1,5-bis(2-methylpropyl)naphthalene-2-sulfonate |
|---|---|
| PubChem CID | 101397592 |
| Molecular Formula | C18H23NaO3S |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | sodium 1,5-bis(2-methylpropyl)naphthalene-2-sulfonate |
| SMILES | CC(C)Cc1cccc2c(CC(C)C)c(S(=O)(=O)[O-])ccc12.[Na+] |
| InChI | InChI=1S/C18H24O3S.Na/c1-12(2)10-14-6-5-7-16-15(14)8-9-18(22(19,20)21)17(16)11-13(3)4;/h5-9,12-13H,10-11H2,1-4H3,(H,19,20,21);/q;+1/p-1 |
| InChIKey | CAFBWAVZNOIBDM-UHFFFAOYSA-M |
| XLogP | 1.14 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|