C13H21ClO5 — CID 101398427
4-O-ethyl 1-O-methyl (2R,3S)-2-chloro-3-hydroxy-2-(1-propan-2-ylcyclopropyl)butanedioate (PubChem CID 101398427) has the molecular formula C13H21ClO5 and a molecular weight of 292.76 g/mol. Its IUPAC name is 4-O-ethyl 1-O-methyl (2R,3S)-2-chloro-3-hydroxy-2-(1-propan-2-ylcyclopropyl)butanedioate.
| Compound Name | 4-O-ethyl 1-O-methyl (2R,3S)-2-chloro-3-hydroxy-2-(1-propan-2-ylcyclopropyl)butanedioate |
|---|---|
| PubChem CID | 101398427 |
| Molecular Formula | C13H21ClO5 |
| Molecular Weight | 292.76 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 4-O-ethyl 1-O-methyl (2R,3S)-2-chloro-3-hydroxy-2-(1-propan-2-ylcyclopropyl)butanedioate |
| SMILES | CCOC(=O)[C@H](O)[C@@](Cl)(C(=O)OC)C1(C(C)C)CC1 |
| InChI | InChI=1S/C13H21ClO5/c1-5-19-10(16)9(15)13(14,11(17)18-4)12(6-7-12)8(2)3/h8-9,15H,5-7H2,1-4H3/t9-,13+/m0/s1 |
| InChIKey | PMJPJHNPTVCMDJ-TVQRCGJNSA-N |
| XLogP | 1.50 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.76 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|